K-858
K-858 is a novel inhibitor of mitotic kinesin Eg5 and antitumor agent, induces cell death in cancer cells. K858 blocked centrosome separation, activated the spindle checkpoint, and induced mitotic arrest in cells accompanied by the formation of monopolar spindles.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72926-24-0 |
| Pricing | Inquire |
| Cas | 72926-24-0 |
| Molecular Weight | 277.34 |
| Molecular Formula | C13H15N3O2S |
| Canonical SMILES | CC(NC1=NN(C(C)=O)C(C2=CC=CC=C2)(C)S1)=O |