2-C-(2,3,4,6-Tetra-O-benzyl-b-D-glucopyranosyl) ethyne
2-C-(2,3,4,6-Tetra-O-benzyl-b-D-glucopyranosyl) ethyne, a complex and intriguing compound, holds immense significance in the realm of biomedicine. Its utilization as a notable tool for investigating the intricate involvement of carbohydrates in drug interactions makes it indispensable. This compound plays a pivotal role in the synthesis of glycosylated drugs, enabling researchers to uncover groundbreaking insights into potential therapeutics for a diverse array of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 168253-07-4 |
| Pricing | Inquire |
| Cas | 168253-07-4 |
| Molecular Weight | 458.55 |
| Molecular Formula | C29H30O5 |
| Canonical SMILES | C#CC1C(C(C(C(O1)COCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |