5-Bromo-4-chloro-3-indolyl b-D-mannopyranoside
5-Bromo-4-chloro-3-indolyl b-D-mannopyranoside is a compound widely used in the biomedical industry as an artificial chromogenic substrate. It is primarily employed in the detection and visualization of β-D-glucosidase enzyme activity. This compound finds applications in various biochemical assays, including determination of bacterial and mammalian β-D-glucosidase levels, providing valuable insights into drug discovery and disease research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129787-67-3 |
| Pricing | Inquire |
| Cas | 129787-67-3 |
| Molecular Weight | 408.63 |
| Molecular Formula | C14H15BrClNO6 |
| Canonical SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |