Elacestrant S enantiomer dihydrochloride
Elacestrant S enantiomer dihydrochloride is a low activity enantiomer of Elacestrant, which is a selective and orally bioavailable small-molecule SERD (IC50s = 48 and 870 nM for ERα and ERβ, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2309762-30-7 |
| Pricing | Inquire |
| Cas | 2309762-30-7 |
| Molecular Weight | 531.56 |
| Molecular Formula | C30H40Cl2N2O2 |
| Canonical SMILES | CCNCCC1=CC=C(C=C1)CN(CC)C2=C(C=CC(=C2)OC)C3CCC4=C(C3)C=CC(=C4)O.Cl.Cl |