4-Sulfophthalic acid
4-Sulfophthalic acid is an indispensable compound in the field of biomedicine and possesses remarkable acidic characteristics. It serves as a pivotal constituent during the synthesis of diverse pharmaceuticals and their intermediates. Efficaciously participating as a reactant, this compound contributes to the fabrication of medications aimed at combatting afflictions including, but not limited to, malignancies, cardiovascular anomalies, and bacterial contagions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89-08-7 |
| Pricing | Inquire |
| Cas | 89-08-7 |
| Molecular Weight | 246.19 |
| Molecular Formula | HO3SC6H3-1,2-(CO2H)2 |
| Canonical SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)C(=O)O |