2-(3,4-Dihydroxyphenyl)ethyl b-D-glucopyranoside
Salidroside, also known as 2-(3,4-Dihydroxyphenyl)ethyl β-D-glucopyranoside, is a naturally occurring compound that can be found in different plants. Its preclinical application has proved its anti-inflammatory, neuroprotective, and antioxidant properties. Traditional medicine considers it as a treatment for ailments such as anxiety, depression, and weariness. Moreover, salidroside has shown promising effects for diseases like cancer, liver injury, and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76873-99-9 |
| Pricing | Inquire |
| Cas | 76873-99-9 |
| Molecular Weight | 316.30 |
| Molecular Formula | C14H20O8 |
| Canonical SMILES | C1=CC(=C(C=C1CCOC2C(C(C(C(O2)CO)O)O)O)O)O |