Calophyllic acid
Calophyllic acid is a natural compound sourced from Calophyllum inophyllum. It exhibits anti-inflammatory and anti-cancer properties, making it a promising candidate in the development of drugs. Calophyllic acid shows potential in studying inflammatory diseases, such as rheumatoid arthritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5102 |
| Pricing | Inquire |
| Cas | 36626-19-4 |
| Molecular Weight | 420.45 |
| Molecular Formula | C25H24O6 |
| Canonical SMILES | CC1C(OC2=C3C=CC(OC3=C(C(=C2C1=O)O)C(=CC(=O)O)C4=CC=CC=C4)(C)C)C |