Lucidenic acid D
Lucidenic acid D, a triterpenoid compound, is extracted from Ganoderma lucidum and is reported to be endowed with multifarious biological activities, such as anti-cancer, anti-inflammatory, and antioxidant properties. With its remarkable potential to stimulate apoptosis in cancer cells, lucidenic acid D stands out as an effective therapeutic candidate for combating cancer and other ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7070 |
| Pricing | Inquire |
| Cas | 98665-16-8 |
| Molecular Weight | 514.61 |
| Molecular Formula | C29H38O8 |
| Canonical SMILES | CC(CCC(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(=O)CC4C3(CCC(=O)C4(C)C)C)OC(=O)C)C)C |