5'-O-DMT-2'-O-TBDMS-N4-Acetyl-L-Cytidine 3'-CE phosphoramidite
5'-O-DMT-2'-O-TBDMS-N4-Acetyl-L-Cytidine 3'-CE phosphoramidite, a remarkable substance within the biomedical field, holds immense significance. Its application in the synthesis of altered oligonucleotides for therapeutic intentions is widespread. Through the specific manipulation and addressing of genetic material, particularly RNA, it exhibits a pivotal role in combating diverse ailments. Boasting an exceptional composition, this product possesses the power to revolutionize precision medicine and propel the progression of targeted therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-291982 |
| Pricing | Inquire |
| Cas | 237060-94-5 |
| Molecular Weight | 902.11 |
| Molecular Formula | C47H64N5O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=CC(=NC2=O)NC(=O)C)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |