6-(4-Morpholino)-9-(b-D-ribofuranosyl)-9H-purine
6-(4-Morpholino)-9-(b-D-ribofuranosyl)-9H-purine is a potent antiviral drug used in the research of certain viral infections exhibiting inhibitory activity against RNA viruses, including influenza and hepatitis C. With its unique molecular structure, this compound interferes with viral replication by targeting key enzymes involved in viral RNA enhancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52940-48-4 |
| Pricing | Inquire |
| Cas | 52940-48-4 |
| Molecular Weight | 337.33 |
| Molecular Formula | C14H19N5O5 |
| Canonical SMILES | C1COCCN1C2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O |