Paldimycin B
It is produced by the strain of Str. paulus 273. It has anti-gram-positive bacterial effect, but also has weak anti-gram-negative bacterial effect. Paldimycin A has stronger antibacterial activity than Paldimycin B.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02348 |
| Pricing | Inquire |
| Cas | 101411-71-6 |
| Molecular Weight | 1099.16 |
| Molecular Formula | C43H62N4O23S3 |
| Canonical SMILES | CC1C(C(CC(O1)OC2C(C(OC(C2OC(=O)C(C(C)SCC(C(=O)O)NC(=O)C)NC(=S)SCC(C(=O)O)NC(=O)C)COC(=O)C)C3(CC(=O)C(=N)C(=C3O)C(=O)O)O)O)OC)(C(C)OC(=O)C(C)C)O |