4-Nitrobenzyl b-D-thiogalactopyranoside
4-Nitrobenzyl b-D-thiogalactopyranoside is a key compound used in research laboratories for the detection and quantification of β-galactosidase activity. It acts as a substrate for this enzyme, producing a yellow product upon enzymatic hydrolysis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35785-19-4 |
| Pricing | Inquire |
| Cas | 35785-19-4 |
| Molecular Weight | 331.34 |
| Molecular Formula | C13H17NO7S |
| Canonical SMILES | C1=CC(=CC=C1CSC2C(C(C(C(O2)CO)O)O)O)[N+](=O)[O-] |