4-Chloro-1-(4-methoxyphenoxy)-2-nitrobenzene
4-Chloro-1-(4-methoxyphenoxy)-2-nitrobenzene is used in the preparation of Amino Hydroxynimesulide (A618310), an analog of Nimesulide (N477500), an antiinflammatory agent. Preferentially inhibits COX-2 over COX-1. Suppresses chemical-induced carcinogenesis in mice and rats. Inhibits LPS-induced TNF-alpha production.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB070030 |
| Pricing | Inquire |
| Cas | 62966-77-2 |
| Molecular Weight | 279.68 |
| Molecular Formula | C13H10ClNO4 |
| Canonical SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |