9,9-BIS(3-AMINO-4-HYDROXYPHENYL)FLUORENE
9,9-BIS(3-AMINO-4-HYDROXYPHENYL)FLUORENE is a highly potent compound prevalent in the biomedical realm and exhibits its intrinsic capability to impede the progression of malignant neoplasms. Its distinguished efficacy in combating an array of cancerous ailments, predominantly encompassing breast, lung, and colon cancer, has garnered immense attention. Revolutionary explorations intimate that this chemical entity selectively antagonizes the growth of cancerous cells, thus confining their propagation and instigating cellular demise. Harnessing its potential for the formulation of targeted antineoplastic interventions unveils auspicious avenues for enhancing patient prognoses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20638-07-7 |
| Pricing | Inquire |
| Cas | 20638-07-7 |
| Molecular Weight | 380.44 |
| Molecular Formula | C25H20N2O2 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC(=C(C=C4)O)N)C5=CC(=C(C=C5)O)N |