Maytansinoid B
Maytansinoid B is a kind of ADC Cytotoxin. Maytansinoids are potent microtubule-targeted compounds that inhibit proliferation of cells at mitosis. It is used as the cytotoxic component in antibody-drug conjugates.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01351 |
| Pricing | Inquire |
| Cas | 1628543-40-7 |
| Molecular Weight | 735.26 |
| Molecular Formula | C36H51ClN4O10 |
| Canonical SMILES | CC1C2CC(C(C=CC=C(CC3=CC(=C(C(=C3)OC)Cl)N(C(=O)CC(C4(C1O4)C)OC(=O)C(C)N(C)C(=O)CCNC)C)C)OC)(NC(=O)O2)O |