N1-b-D-Galactopyranosylamino-guanidine HNO3
N1-b-D-Galactopyranosylamino-guanidine HNO3 is a specialized compound utilized in biomedicine for its potential in treating diabetes. Acting as a potential antiglycation agent, it aims to regulate blood glucose levels by inhibiting the formation of Advanced Glycation End Products (AGEs).
| Supplier | BOC Sciences |
|---|---|
| Product # | 109853-86-3 |
| Pricing | Inquire |
| Cas | 109853-86-3 |
| Molecular Weight | 299.24 |
| Molecular Formula | C7H17N5O8 |
| Canonical SMILES | C(C1C(C(C(C(O1)NN=C(N)N)O)O)O)O.[N+](=O)(O)[O-] |