Altechromone A
Altechromone A is produced from Alternaria brassicicola ML-P08. Altechromone A shows antimicrobial activity against Bacillus subtilis, Escherichia coli, Pseudomonas fluorescens and Candida albicans with the MICs of 3.9, 3.9, 1.8, and 3.9 ug/ml, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38412-47-4 |
| Pricing | Inquire |
| Cas | 38412-47-4 |
| Molecular Weight | 190.19 |
| Molecular Formula | C11H10O3 |
| Canonical SMILES | CC1=CC(=CC2=C1C(=O)C=C(O2)C)O |