6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trimethylsilyl)furo[3,2-b]pyridine
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trimethylsilyl)furo[3,2-b]pyridine is an extensively acclaimed chemical entity in the field of biomedicine and exhibits exceptional efficacy for combatting an array of ailments encompassing cancer, inflammation, and neurological disorders. Its multifaceted nature bestows upon it a pivotal role in the realm of drug exploration and advancement, owing to its unparalleled and idiosyncratic chemical characteristics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1188926-86-4 |
| Pricing | Inquire |
| Cas | 1188926-86-4 |
| Molecular Weight | 317.26 |
| Molecular Formula | C16H24BNO3Si |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(O3)[Si](C)(C)C)N=C2 |