3-(Triallylsilyl)propyl Methacrylate (stabilized with MEHQ)
3-(Triallylsilyl)propyl Methacrylate (stabilized with MEHQ) is used as a cross-linking agent in the biomedical field and plays a key role in the production of biomaterials and drug delivery systems. By integrating it, the material's stability and biocompatibility can be significantly improved, making it beneficial for applications as diverse as tissue engineering, precisely controlled drug release, and targeted therapeutic intervention in a range of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1990509-31-3 |
| Pricing | Inquire |
| Cas | 1990509-31-3 |
| Molecular Weight | 278.47 |
| Molecular Formula | C16H26O2Si |
| Canonical SMILES | CC(=C)C(=O)OCCC[Si](CC=C)(CC=C)CC=C |