DMT-2'-O-4'-C Locked-Tr-CE Phosphoramidite
DMT-2'-O-4'-C Locked-Tr-CE Phosphoramidite is a phosphoramidite compound used for the synthesis of locked nucleic acids (LNAs). This molecule is derived from a nucleoside and features several key modifications: a dimethoxytrityl (DMT) group at the 5' position, a 2'-O-4'-C methylene bridge (creating a locked ribose conformation), and a cyanoethyl (CE) phosphoramidite group for incorporation into oligonucleotides. DMT-2'-O-4'-C Locked-Tr-CE Phosphoramidite is valuable in various applications, including antisense therapy, siRNA, miRNA research, and diagnostic assays. The enhanced stability and binding properties of LNA-modified oligonucleotides make them powerful tools in molecular biology and medical research, providing greater specificity and efficacy in targeting RNA or DNA sequences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 206055-75-6 |
| Pricing | Inquire |
| Cas | 206055-75-6 |
| Molecular Weight | 772.84 |
| Molecular Formula | C41H49N4O9P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C3C(C(O2)(CO3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N |