2-Methyl-4-nitrobenzoic acid
2-Methyl-4-nitrobenzoic acid (CAS# 1975-51-5) is used as a reagent to synthesize amino-1H-pyrazole amide derivatives, compounds that act as Raf kinase inhibitors in melanoma cells. 2-Methyl-4-nitrobenzoic acid is also used as a reagent to synthesize fluorogenic substrates, compounds that can be used for activity imaging within living cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3335 |
| Pricing | Inquire |
| Cas | 1975-51-5 |
| Molecular Weight | 181.15 |
| Molecular Formula | C8H7NO4 |
| Canonical SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)O |