5'-Deoxy-5'-iodo-2'-O-methyl-5-methyluridine
5'-Deoxy-5'-iodo-2'-O-methyl-5-methyluridine, a pivotal compound extensively utilized in the biomedical realm, assumes a crucial role in the progressive field of antiviral drug development, chiefly focusing on RNA viruses including hepatitis C and HIV. Its exceptional configuration bestows it with formidable antiviral capabilities, thus presenting a propitious alternative in the battle against these prevailing infectious ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 187733-72-8 |
| Pricing | Inquire |
| Cas | 187733-72-8 |
| Molecular Weight | 382.15 |
| Molecular Formula | C11H15IN2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CI)O)OC |