Resorufin N-acetyl-b-D-glucosamine
Resorufin N-acetyl-b-D-glucosamine is a powerful biomedical tool, playing a crucial role in deciphering and studying multifarious enzymatic responses across diverse pathological conditions. With innate fluorogenic properties, it proficiently serves as a versatile substrate for key enzymes encompassing glucosaminidases, chitinases and glycosidases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 124762-32-9 |
| Pricing | Inquire |
| Cas | 124762-32-9 |
| Molecular Weight | 416.38 |
| Molecular Formula | C20H20N2O8 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC3=C(C=C2)N=C4C=CC(=O)C=C4O3)CO)O)O |