3'-Deoxy-3'-fluoro-2-thiouridine
3'-Deoxy-3'-fluoro-2-thiouridine is an exceptionally powerful antiviral compound extensively employed in the biomedical sector, functioning as a nucleoside analog. This compound exerts its remarkable influence on impeding viral duplication via the inhibition of RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 439579-24-5 |
| Pricing | Inquire |
| Cas | 439579-24-5 |
| Molecular Weight | 262.26 |
| Molecular Formula | C9H11FN2O4S |
| Canonical SMILES | C1=CN(C(=S)NC1=O)C2C(C(C(O2)CO)F)O |