2'-O-tert-Butyldimethylsilyl-N-(tert-butylphenoxyacetyl)-5'-O-DMT-guanosine 3'-CE phosphoramidite
2'-O-tert-Butyldimethylsilyl-N-(tert-butylphenoxyacetyl)-5'-O-DMT-guanosine 3'-CE phosphoramidite is a crucial component in the compound industry. It is used in the research and development of oligonucleotides for various applications, including the reserch and study of genetic disorders and diseases. This compound plays a vital role in the development of effective drugs targeting specific genes, offering great potential for personalized medicine and gene therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149989-68-4 |
| Pricing | Inquire |
| Cas | 149989-68-4 |
| Molecular Weight | 1090.32 |
| Molecular Formula | C58H76N7O10PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=NC3=C2N=C(NC3=O)NC(=O)COC4=CC=C(C=C4)C(C)(C)C)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |