2-Naphthaleneboronic Acid
Used in a study of an enantioselective rhodium-catalyzed addition of aryl boronic acids to 2,2,2-trifluoroacetophenones leading to chiral, tertiary trifluoromethyl alcohols. Also employed in a study of a palladium-catalyzed addition of aryl boronic acids to nitriles providing aryl ketones and to aryloxy nitriles providing benzofurans.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB021254 |
| Pricing | Inquire |
| Cas | 32316-92-0 |
| Molecular Weight | 171.99 |
| Molecular Formula | C10H9O2B |
| Canonical SMILES | B(C1=CC2=CC=CC=C2C=C1)(O)O |