Pentoxyverine citrate
Pentoxyverine Citrate is an antitussive (cough suppressant) commonly used for cough associated with illnesses like common cold.It is sold over-the-counter in the United States as Solotuss,or in combination with other medications, especially decongestants.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2636 |
| Pricing | Inquire |
| Cas | 23142-01-0 |
| Molecular Weight | 525.59 |
| Molecular Formula | C20H31NO3.C6H8O7 |
| Canonical SMILES | CCN(CC)CCOCCOC(=O)C1(CCCC1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |