2',3',5'-Tri-O-acetyl-5-methoxycarbonylmethyl-2-thiouridine
2',3',5'-Tri-O-acetyl-5-methoxycarbonylmethyl-2-thiouridine - a nucleoside derivative - serves as a research reagent, delving into the intricacies of RNA modifications. Through analyses of the effects of this modification on RNA molecule stability and structure, research personas can broaden their understanding of these elusive biomolecules. As such, it is not approved for human or veterinary applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1613530-52-1 |
| Pricing | Inquire |
| Cas | 1613530-52-1 |
| Molecular Weight | 458.44 |
| Molecular Formula | C18H22N2O10S |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=C(C(=O)NC2=S)CC(=O)OC)OC(=O)C)OC(=O)C |