Radicamine B
Radicamine B, a formidable antitumor antibiotic, exerts its actions as a DNA intercalator and DNA polymerase inhibitor, thereby inducing cancer cell apoptosis. Remarkably efficacious in combating diverse cancer forms, such as breast, lung, and colon cancer, this compound stands as a hopeful beacon in the fight against neoplastic disorders. Its remarkable potential warrants further exploration and experimentation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 431981-75-8 |
| Pricing | Inquire |
| Cas | 431981-75-8 |
| Molecular Weight | 225.24 |
| Molecular Formula | C11H15NO4 |
| Canonical SMILES | C1=CC(=CC=C1C2C(C(C(N2)CO)O)O)O |