5'-Azido-5'-deoxy-2'-O-methyl-5-methyluridine
5'-Azido-5'-deoxy-2'-O-methyl-5-methyluridine is a remarkably versatile compound, finding extensive employment in the realm of biomedical research. Augmenting the understanding of DNA research and development, RNA labeling and nucleic acid modification, this compound unfolds indispensable avenues for scientific exploration. Revered for its unwavering chemical stability and unparalleled affinity, it manifests promising prospects as a transformative cog in antiviral drug development.
Supplier | BOC Sciences |
---|---|
Product # | 187733-73-9 |
Pricing | Inquire |
Cas | 187733-73-9 |
Molecular Weight | 297.27 |
Molecular Formula | C11H15N5O5 |
Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CN=[N+]=[N-])O)OC |