2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-glucopyranose
2-Acetamido-1,3,6-tri-O-acetyl-2,4-dideoxy-4-fluoro-D-glucopyranose is an intriguing compound of interest in the biomedical sector, exhibiting immense promise as a foundational building block for curating novel therapeutic agents. Its intricate molecular configuration and distinct characteristics render it an ideal candidate for scientific investigations focusing on the development of carbohydrate-derived medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 116049-57-1 |
| Pricing | Inquire |
| Cas | 116049-57-1 |
| Molecular Weight | 349.31 |
| Molecular Formula | C14H20FNO8 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC(=O)C)COC(=O)C)F)OC(=O)C |