2',4'-Dihydroxy-4,6'-dimethoxydihydrochalcone
2',4'-Dihydroxy-4,6'-dimethoxydihydrochalcone belongs to a kind of chalcones, which is extracted from the herbs of Cedrus deodara. It is a predicted metabolite generated by BioTransformer. It is generated through an o-dealkylation reaction, which occurs in humans and is generated by cyp2a6, cyp2c9, and cyp2c19 enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75679-58-2 |
| Pricing | Inquire |
| Cas | 75679-58-2 |
| Molecular Weight | 302.32 |
| Molecular Formula | C17H18O5 |
| Canonical SMILES | COC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2OC)O)O |