2,4-Dimethoxyphenylboronic Acid
2,4-Dimethoxyphenylboronic acid can be used: As a reactant in meatal-catalyzed Suzuki−Miyaura cross-coupling reaction; To prepare hydroxy(trimethoxy)phenanthrene by cross-coupling with bromo(benzyloxy)methoxybenzaldehyde followed by condensation and debenzylation reaction; To synthesize 2,4-dimethoxy-1-(trifluoromethyl)benzene via Cu-catalyzed trifluoromethylation reaction.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB007801 |
| Pricing | Inquire |
| Cas | 133730-34-4 |
| Molecular Weight | 181.98 |
| Molecular Formula | C8H11O4B |
| Canonical SMILES | B(C1=C(C=C(C=C1)OC)OC)(O)O |