2,3-O-Isopropylidene-1,5-di-O-toluoyl-b-D-ribofuranose
2,3-O-Isopropylidene-1,5-di-O-toluoyl-b-D-ribofuranose, a multifaceted compound, holds immense significance in the field of biomedical research. Its primary usage lies in the synthesis of antiviral medications aimed at RNA-dependent RNA polymerases. Moreover, this compound serves as a valuable tool in the investigation of metabolic disorders, such as diabetes, facilitating an in-depth analysis of glucose metabolism and glycemic control.
| Supplier | BOC Sciences |
|---|---|
| Product # | 86042-28-6 |
| Pricing | Inquire |
| Cas | 86042-28-6 |
| Molecular Weight | 426.47 |
| Molecular Formula | C24H26O7 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C3C(C(O2)OC(=O)C4=CC=C(C=C4)C)OC(O3)(C)C |