5-Chloroindole-2-carboxylic acid
5-Chloroindole-2-carboxylic acid (CAS# 10517-21-2) is used in the synthesis of 4-(3-aminomethylphenyl)piperidine-1-carboxamides as potent, selective, and orally bioavailable inhibitors of βII tryptase. It is also a reagent used to prepare indole amides with possible antihistaminic activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10517-21-2 |
| Pricing | Inquire |
| Cas | 10517-21-2 |
| Molecular Weight | 195.60 |
| Molecular Formula | C9H6ClNO2 |
| Canonical SMILES | C1=CC2=C(C=C1Cl)C=C(N2)C(=O)O |