(2S,3R,4S,5R)-2-(6-Amino-2-chloro-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol hydrochloride
(2S,3R,4S,5R)-2-(6-Amino-2-chloro-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol hydrochloride, an anti-cancer drug, exerts its therapeutic effects by suppressing enzymatic activity vital to cancer cell growth and spread. Regarded as a crucial component in the treatment of malignancies such as non-small cell lung cancer, colorectal cancer, and pancreatic cancer, this agent is administered in tandem with other chemo-therapeutic agents, although adverse events such as nausea, vomiting, and diarrhea must be carefully monitored.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2015222-38-3 |
| Pricing | Inquire |
| Cas | 2015222-38-3 |
| Molecular Weight | 338.15 |
| Molecular Formula | C10H13Cl2N5O4 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N.Cl |