Pyrene-[d10]
Pyrene-[d10] is an isotope form of Pyrene. Pyrene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, resulting in a flat aromatic system. Pyrene occurs in coal tar. Pyrene is also obtained by the destructive hydrogenation of hard coal.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1718-52-1 |
| Pricing | Inquire |
| Cas | 1718-52-1 |
| Molecular Weight | 212.31 |
| Molecular Formula | C16D10 |
| Canonical SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |