Amorfrutin A
Amorfrutin is a natural product isolated from A. fruticosa and G. foetida. Amorfrutin exhibits antidiabetic properties. Amorfrutin binds to and activate PPARγ with a Ki of 0.236 µM and activates a PPARγ gene reporter assay with an EC50 value of 0.458 µM, which results in selective gene expression involved with lipid and glucose metabolism. Amorfrutin is a glucose-lowering agent and can improves insulin sensitivity, glucose tolerance and blood lipid variables without increase of fat storage or hepatoxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 80489-90-3 |
| Pricing | Inquire |
| Cas | 80489-90-3 |
| Molecular Weight | 340.4 |
| Molecular Formula | C21H24O4 |
| Canonical SMILES | COC1=C(CC=C(C)C)C(O)=C(C(O)=O)C(CCC2=CC=CC=C2)=C1 |