N3-Allyluridine
N3-Allyluridine is a biomedicine used to treat viral infections, specifically herpes simplex and varicella-zoster viruses. With its antiviral properties, this product inhibits viral DNA synthesis to suppress viral replication. Extensively studied and researched, N3-Allyluridine has shown promising results in the treatment of these viral diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103951-13-9 |
| Pricing | Inquire |
| Cas | 103951-13-9 |
| Molecular Weight | 284.27 |
| Molecular Formula | C12H16N2O6 |
| Canonical SMILES | C=CCN1C(=O)C=CN(C1=O)C2C(C(C(O2)CO)O)O |