Tetracycline 10-O-b-D-galactopyranoside
Tetracycline 10-O-b-D-galactopyranoside, an artificially derived compound, plays a pivotal role in biomedicine, being highly effective against bacterial infections. Through the process of prodrug conversion, it metamorphoses into tetracycline, an extensive-ranging antibiotic.
| Supplier | BOC Sciences |
|---|---|
| Product # | 319426-63-6 |
| Pricing | Inquire |
| Cas | 319426-63-6 |
| Molecular Weight | 606.58 |
| Molecular Formula | C28H34N2O13 |
| Canonical SMILES | CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4OC5C(C(C(C(O5)CO)O)O)O)O)O)O)C(=O)N)N(C)C)O |