(E)-1-(4-(4-(2-Methylbut-2-en-1-yl)piperazin-1-yl)phenyl)ethanone
(E)-1-(4-(4-(2-Methylbut-2-en-1-yl)piperazin-1-yl)phenyl)ethanone is an intermediate in the synthesis of (E)-1-(4-(4-(2-Methylbut-2-en-1-yl)piperazin-1-yl)phenyl)ethanone Hydrochloride (M725995), which is a piperazinyl phenylethanone compound that acts as an inhibitor of traffic between the trans-Golgi network (TGN) and endosomes that depends on the clathrin adaptor complex AP-1. Additionally, Membrane Traffic Inhibitor, A5 has been shown to have little effect against other trafficking pathways involving endosomes and TGN.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058928 |
| Pricing | Inquire |
| Cas | 938071-77-3 |
| Molecular Weight | 272.39 |
| Molecular Formula | C17H24N2O |
| Canonical SMILES | CC=C(C)CN1CCN(CC1)C2=CC=C(C=C2)C(=O)C |