4-Nitrophenyl b-D-cellopentaoside
4-Nitrophenyl b-D-cellopentaoside is a carbohydrate derivative widely used in the biomedical industry. It is primarily employed as a substrate for enzyme assays and as a model compound for investigating enzymatic activities related to cellulosic biomass conversion. This compound has significant applications in drug development, particularly in understanding how certain drugs interact with cellulosic substrates and in studying diseases associated with cellulosic metabolism disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129411-63-8 |
| Pricing | Inquire |
| Cas | 129411-63-8 |
| Molecular Weight | 949.81 |
| Molecular Formula | C36H55NO28 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O)O)O)O |