Cortisone acetate
Cortisone acetate (Cortone) is an acetate salt form of cortisone that is a steroid hormone and a glucocorticoid. It can be used for various inflammations, allergic diseases, bovine ketonemia, sheep pregnancy toxemia, etc.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3148 |
| Pricing | Inquire |
| Cas | 50-04-4 |
| Molecular Weight | 402.48 |
| Molecular Formula | C23H30O6 |
| Canonical SMILES | CC(=O)OCC(=O)C1(CCC2C1(CC(=O)C3C2CCC4=CC(=O)CCC34C)C)O |