5'-Deoxy-5'-iodo-5-methyluridine
5'-Deoxy-5'-iodo-5-methyluridine is an exceptionally potent pharmaceutical compound, playing an important role in synthesizing nucleoside analogs. It is an invaluable component in antiviral therapies targeting DNA and RNA viruses. By curbing viral replication, this compound delineate its efficacy in research of viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1884334-62-6 |
| Pricing | Inquire |
| Cas | 1884334-62-6 |
| Molecular Weight | 368.13 |
| Molecular Formula | C10H13IN2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CI)O)O |