Chrysanthellin B
Chrysanthellin B, an exudate derived from the botanical species Chrysanthellum indicum, exhibits remarkable bioactivity attributed to its intrinsic phytochemical constituents. This naturally occurring compound, renowned for its formidable antioxidative prowess, has demonstrated significant potential as a therapeutic agent in combating a plethora of ailments including malignant neoplasms and hepatic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74411-65-7 |
| Pricing | Inquire |
| Cas | 74411-65-7 |
| Molecular Weight | 1207.35 |
| Molecular Formula | C58H94O26 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(COC(C2O)OC3C(OC(C(C3O)O)OC4C(C(COC4OC(=O)C56CCC(CC5C7=CCC8C9(CCC(C(C9CCC8(C7(CC6O)C)C)(C)CO)OC1C(C(C(C(O1)CO)O)O)O)C)(C)C)O)O)C)O)O)O)O |