6α-Hydroxy Prednisolone Acetate
6α-Hydroxy Prednisolone Acetate is a metabolite of Prednisolone, which is a synthetic glucocorticoid, a derivative of cortisol, and can be used to treat a variety of inflammatory and auto-immune conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 134526-05-9 |
| Pricing | Inquire |
| Cas | 134526-05-9 |
| Molecular Weight | 418.48 |
| Molecular Formula | C23H30O7 |
| Canonical SMILES | CC(=O)OCC(=O)C1(CCC2C1(CC(C3C2CC(C4=CC(=O)C=CC34C)O)O)C)O |