1-Deoxy-1-nitro-L-iditol hemihydrate
1-Deoxy-1-nitro-L-iditol hemihydrate, an innovative biomedical product, unfolds an array of mesmerizing therapeutic possibilities in combating neurodegenerative disorders like Alzheimer's disease and Parkinson's disease. With its exceptional structural arrangement and distinct properties, it emerges as an auspicious contender for the development of pharmacological interventions targeting these incapacitating ailments.
Supplier | BOC Sciences |
---|---|
Product # | 207226-23-1 |
Pricing | Inquire |
Cas | 207226-23-1 |
Molecular Weight | 229.19 |
Molecular Formula | C6H15NO8 |
Canonical SMILES | C(C(C(C(C(CO)O)O)O)O)[N+](=O)[O-].O |