Clobetasol-[d5]
Clobetasol-[d5], is the labelled analogue of Clobetasol, which is an impurity of Clobetasol propionate. Clobetasol propionate is a corticosteroid of the glucocorticoid class used to treat various skin disorders including eczema and psoriasis. It is also highly effective for contact dermatitis caused by exposure to poison ivy/oak.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002300 |
| Pricing | Inquire |
| Molecular Weight | 415.94 |
| Molecular Formula | C22H23D5ClFO4 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CCl)O)C)O)F)C |