N4-Benzoyl-2'-deoxy-5'-O-DMT-5-methylcytidine 3'-CE phosphoramidite
N4-Benzoyl-2'-deoxy-5'-O-DMT-5-methylcytidine 3'-CE phosphoramidite is widely used in the biomedical industry as a building block for synthesizing modified nucleotides. It plays a crucial role in the research of pharmaceutical drugs targeting specific diseases, such as cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-155120 |
| Pricing | Inquire |
| Cas | 105931-57-5 |
| Molecular Weight | 847.93 |
| Molecular Formula | C47H54N5O8P |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N |