9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(pyridine-4-yl)purine
9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(pyridine-4-yl)purine is a potent antiviral compound used in the research of viral infections, including certain strains of influenza and herpes viruses. It acts by inhibiting viral replication, thus reducing the severity and duration of the infection. Extensive research has shown promising results in its therapeutic efficacy against a range of viral diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612191-93-1 |
| Pricing | Inquire |
| Cas | 1612191-93-1 |
| Molecular Weight | 331.30 |
| Molecular Formula | C15H14FN5O3 |
| Canonical SMILES | C1=CN=CC=C1C2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)F)O |